C12H13ClN4O2 — CID 107198052
5-amino-3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxybenzamide (PubChem CID 107198052) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxybenzamide.
| Compound Name | 5-amino-3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxybenzamide |
|---|---|
| PubChem CID | 107198052 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-amino-3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxybenzamide |
| SMILES | Cc1cc(Oc2c(Cl)cc(N)cc2C(N)=O)n(C)n1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-6-3-10(17(2)16-6)19-11-8(12(15)18)4-7(14)5-9(11)13/h3-5H,14H2,1-2H3,(H2,15,18) |
| InChIKey | UOTWBIPVTNNPAS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|