C12H12ClN3OS — CID 81346149
2-chloro-6-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide (PubChem CID 81346149) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide.
| Compound Name | 2-chloro-6-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 81346149 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-chloro-6-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide |
| SMILES | Cc1cc(Oc2cccc(Cl)c2C(N)=S)n(C)n1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-7-6-10(16(2)15-7)17-9-5-3-4-8(13)11(9)12(14)18/h3-6H,1-2H3,(H2,14,18) |
| InChIKey | WJJHTTHNGJCCRK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|