C12H12BrN3OS — CID 114903777
4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide (PubChem CID 114903777) has the molecular formula C12H12BrN3OS and a molecular weight of 326.22 g/mol. Its IUPAC name is 4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide.
| Compound Name | 4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 114903777 |
| Molecular Formula | C12H12BrN3OS |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxybenzenecarbothioamide |
| SMILES | Cc1cc(Oc2cc(Br)ccc2C(N)=S)n(C)n1 |
| InChI | InChI=1S/C12H12BrN3OS/c1-7-5-11(16(2)15-7)17-10-6-8(13)3-4-9(10)12(14)18/h3-6H,1-2H3,(H2,14,18) |
| InChIKey | ZPDYVMBAPUDGAM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|