About [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine
[4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine (PubChem CID 114900847) has the molecular formula C12H14BrN3O
and a molecular weight of 296.17 g/mol. Its IUPAC name is [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine.
Molecular Properties
| Compound Name | [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine |
| PubChem CID | 114900847 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine |
| SMILES | Cc1cc(Oc2cc(Br)ccc2CN)n(C)n1 |
| InChI | InChI=1S/C12H14BrN3O/c1-8-5-12(16(2)15-8)17-11-6-10(13)4-3-9(11)7-14/h3-6H,7,14H2,1-2H3 |
| InChIKey | MZSQTHAVBGFSPE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine?
The IUPAC name of [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine (CID 114900847) is [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine.
What is the SMILES notation for [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine?
The canonical SMILES for [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine is Cc1cc(Oc2cc(Br)ccc2CN)n(C)n1.
What is the InChIKey of [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine?
The InChIKey is MZSQTHAVBGFSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3O/c1-8-5-12(16(2)15-8)17-11-6-10(13)4-3-9(11)7-14/h3-6H,7,14H2,1-2H3.
What are the key properties of [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine?
[4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine has a molecular weight of 296.17 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-(2,5-dimethylpyrazol-3-yl)oxyphenyl]methanamine is sourced from PubChem (CID 114900847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).