C13H7Br2Cl2NOS — CID 107658112
4-bromo-2-(4-bromo-2,5-dichlorophenoxy)benzenecarbothioamide (PubChem CID 107658112) has the molecular formula C13H7Br2Cl2NOS and a molecular weight of 455.99 g/mol. Its IUPAC name is 4-bromo-2-(4-bromo-2,5-dichlorophenoxy)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(4-bromo-2,5-dichlorophenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 107658112 |
| Molecular Formula | C13H7Br2Cl2NOS |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 452.80 |
| IUPAC Name | 4-bromo-2-(4-bromo-2,5-dichlorophenoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H7Br2Cl2NOS/c14-6-1-2-7(13(18)20)11(3-6)19-12-5-9(16)8(15)4-10(12)17/h1-5H,(H2,18,20) |
| InChIKey | GBBVOJDVJFJUFY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|