C12H7BrCl2N2OS — CID 107658134
3-(4-bromo-2,5-dichlorophenoxy)pyridine-2-carbothioamide (PubChem CID 107658134) has the molecular formula C12H7BrCl2N2OS and a molecular weight of 378.08 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dichlorophenoxy)pyridine-2-carbothioamide.
| Compound Name | 3-(4-bromo-2,5-dichlorophenoxy)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 107658134 |
| Molecular Formula | C12H7BrCl2N2OS |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 375.88 |
| IUPAC Name | 3-(4-bromo-2,5-dichlorophenoxy)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ncccc1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C12H7BrCl2N2OS/c13-6-4-8(15)10(5-7(6)14)18-9-2-1-3-17-11(9)12(16)19/h1-5H,(H2,16,19) |
| InChIKey | FFPAKFOSJYIUNL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|