C13H9BrCl2N2O2 — CID 107659948
3-amino-2-(4-bromo-2,5-dichlorophenoxy)benzamide (PubChem CID 107659948) has the molecular formula C13H9BrCl2N2O2 and a molecular weight of 376.04 g/mol. Its IUPAC name is 3-amino-2-(4-bromo-2,5-dichlorophenoxy)benzamide.
| Compound Name | 3-amino-2-(4-bromo-2,5-dichlorophenoxy)benzamide |
|---|---|
| PubChem CID | 107659948 |
| Molecular Formula | C13H9BrCl2N2O2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 3-amino-2-(4-bromo-2,5-dichlorophenoxy)benzamide |
| SMILES | NC(=O)c1cccc(N)c1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H9BrCl2N2O2/c14-7-4-9(16)11(5-8(7)15)20-12-6(13(18)19)2-1-3-10(12)17/h1-5H,17H2,(H2,18,19) |
| InChIKey | JDZHAJIIDWFUFT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|