C13H6BrF13 — CID 10719829
1-bromo-4-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]benzene (PubChem CID 10719829) has the molecular formula C13H6BrF13 and a molecular weight of 489.07 g/mol. Its IUPAC name is 1-bromo-4-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]benzene.
| Compound Name | 1-bromo-4-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]benzene |
|---|---|
| PubChem CID | 10719829 |
| Molecular Formula | C13H6BrF13 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | 1-bromo-4-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(Cc1ccc(Br)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H6BrF13/c14-7-3-1-6(2-4-7)5-8(11(19,20)21,12(22,23)24)9(15,16)10(17,18)13(25,26)27/h1-4H,5H2 |
| InChIKey | XNXSDDUAQKULBW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|