C10H21F3N2O — CID 107198399
5-[(3-amino-1,1,1-trifluorobutan-2-yl)-methylamino]pentan-1-ol (PubChem CID 107198399) has the molecular formula C10H21F3N2O and a molecular weight of 242.28 g/mol. Its IUPAC name is 5-[(3-amino-1,1,1-trifluorobutan-2-yl)-methylamino]pentan-1-ol.
| Compound Name | 5-[(3-amino-1,1,1-trifluorobutan-2-yl)-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107198399 |
| Molecular Formula | C10H21F3N2O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 5-[(3-amino-1,1,1-trifluorobutan-2-yl)-methylamino]pentan-1-ol |
| SMILES | CC(N)C(N(C)CCCCCO)C(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O/c1-8(14)9(10(11,12)13)15(2)6-4-3-5-7-16/h8-9,16H,3-7,14H2,1-2H3 |
| InChIKey | XNZRYWHANPSYNC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|