C12H28N2O — CID 62985674
3-N-(3-methoxypropyl)-3-N,4,4-trimethylpentane-2,3-diamine (PubChem CID 62985674) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 3-N-(3-methoxypropyl)-3-N,4,4-trimethylpentane-2,3-diamine.
| Compound Name | 3-N-(3-methoxypropyl)-3-N,4,4-trimethylpentane-2,3-diamine |
|---|---|
| PubChem CID | 62985674 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 3-N-(3-methoxypropyl)-3-N,4,4-trimethylpentane-2,3-diamine |
| SMILES | COCCCN(C)C(C(C)N)C(C)(C)C |
| InChI | InChI=1S/C12H28N2O/c1-10(13)11(12(2,3)4)14(5)8-7-9-15-6/h10-11H,7-9,13H2,1-6H3 |
| InChIKey | JXNKLMKTFCTXNY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|