C12H28N2O2 — CID 114357181
3-amino-2-[3-methoxypropyl(methyl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 114357181) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-amino-2-[3-methoxypropyl(methyl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-[3-methoxypropyl(methyl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114357181 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 3-amino-2-[3-methoxypropyl(methyl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | COCCCN(C)C(CO)C(N)C(C)(C)C |
| InChI | InChI=1S/C12H28N2O2/c1-12(2,3)11(13)10(9-15)14(4)7-6-8-16-5/h10-11,15H,6-9,13H2,1-5H3 |
| InChIKey | OLVVMGUPPFRZDV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|