C13H30N2O — CID 114356628
3-amino-4,4-dimethyl-2-[methyl(pentyl)amino]pentan-1-ol (PubChem CID 114356628) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-2-[methyl(pentyl)amino]pentan-1-ol.
| Compound Name | 3-amino-4,4-dimethyl-2-[methyl(pentyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 114356628 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 3-amino-4,4-dimethyl-2-[methyl(pentyl)amino]pentan-1-ol |
| SMILES | CCCCCN(C)C(CO)C(N)C(C)(C)C |
| InChI | InChI=1S/C13H30N2O/c1-6-7-8-9-15(5)11(10-16)12(14)13(2,3)4/h11-12,16H,6-10,14H2,1-5H3 |
| InChIKey | AUJHXROWVJQGRM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|