C10H23NO3 — CID 137483960
(3R,4R)-2-[butyl(methyl)amino]pentane-1,3,4-triol (PubChem CID 137483960) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (3R,4R)-2-[butyl(methyl)amino]pentane-1,3,4-triol.
| Compound Name | (3R,4R)-2-[butyl(methyl)amino]pentane-1,3,4-triol |
|---|---|
| PubChem CID | 137483960 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | (3R,4R)-2-[butyl(methyl)amino]pentane-1,3,4-triol |
| SMILES | CCCCN(C)C(CO)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C10H23NO3/c1-4-5-6-11(3)9(7-12)10(14)8(2)13/h8-10,12-14H,4-7H2,1-3H3/t8-,9?,10+/m1/s1 |
| InChIKey | YSMBYIGBJUDBNF-FIBVVXLUSA-N |
| XLogP | -0.18 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |