C10H23NO4 — CID 130199633
(3S)-2-[butyl(2,2-dihydroxyethyl)amino]butane-1,3-diol (PubChem CID 130199633) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S)-2-[butyl(2,2-dihydroxyethyl)amino]butane-1,3-diol.
| Compound Name | (3S)-2-[butyl(2,2-dihydroxyethyl)amino]butane-1,3-diol |
|---|---|
| PubChem CID | 130199633 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (3S)-2-[butyl(2,2-dihydroxyethyl)amino]butane-1,3-diol |
| SMILES | CCCCN(CC(O)O)C(CO)[C@H](C)O |
| InChI | InChI=1S/C10H23NO4/c1-3-4-5-11(6-10(14)15)9(7-12)8(2)13/h8-10,12-15H,3-7H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | PYOZQZDIEMFDMN-IENPIDJESA-N |
| XLogP | -0.86 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|