C9H21NO3 — CID 121452059
2-(diethylamino)pentane-1,3,4-triol (PubChem CID 121452059) has the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(diethylamino)pentane-1,3,4-triol.
| Compound Name | 2-(diethylamino)pentane-1,3,4-triol |
|---|---|
| PubChem CID | 121452059 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 2-(diethylamino)pentane-1,3,4-triol |
| SMILES | CCN(CC)C(CO)C(O)C(C)O |
| InChI | InChI=1S/C9H21NO3/c1-4-10(5-2)8(6-11)9(13)7(3)12/h7-9,11-13H,4-6H2,1-3H3 |
| InChIKey | PAQRGMPIZLLKJN-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |