C10H23NO6 — CID 142783213
(2R,3S,4R,5S)-1-(diethylamino)hexane-1,2,3,4,5,6-hexol (PubChem CID 142783213) has the molecular formula C10H23NO6 and a molecular weight of 253.29 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-(diethylamino)hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5S)-1-(diethylamino)hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 142783213 |
| Molecular Formula | C10H23NO6 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2R,3S,4R,5S)-1-(diethylamino)hexane-1,2,3,4,5,6-hexol |
| SMILES | CCN(CC)C(O)[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H23NO6/c1-3-11(4-2)10(17)9(16)8(15)7(14)6(13)5-12/h6-10,12-17H,3-5H2,1-2H3/t6-,7+,8-,9+,10?/m0/s1 |
| InChIKey | SWFFWYLYOYUBFV-FLZHQEHWSA-N |
| XLogP | -2.92 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|