C16H27ClN2O — CID 107201277
5-[2-chloro-N-methyl-4-[(propan-2-ylamino)methyl]anilino]pentan-1-ol (PubChem CID 107201277) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 5-[2-chloro-N-methyl-4-[(propan-2-ylamino)methyl]anilino]pentan-1-ol.
| Compound Name | 5-[2-chloro-N-methyl-4-[(propan-2-ylamino)methyl]anilino]pentan-1-ol |
|---|---|
| PubChem CID | 107201277 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-[2-chloro-N-methyl-4-[(propan-2-ylamino)methyl]anilino]pentan-1-ol |
| SMILES | CC(C)NCc1ccc(N(C)CCCCCO)c(Cl)c1 |
| InChI | InChI=1S/C16H27ClN2O/c1-13(2)18-12-14-7-8-16(15(17)11-14)19(3)9-5-4-6-10-20/h7-8,11,13,18,20H,4-6,9-10,12H2,1-3H3 |
| InChIKey | IDTWTTZASZTEEB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|