C13H24N4O2 — CID 107203152
5-tert-butyl-N-(5-hydroxypentyl)-N-methyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 107203152) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-tert-butyl-N-(5-hydroxypentyl)-N-methyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(5-hydroxypentyl)-N-methyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 107203152 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 5-tert-butyl-N-(5-hydroxypentyl)-N-methyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN(CCCCCO)C(=O)c1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H24N4O2/c1-13(2,3)12-14-10(15-16-12)11(19)17(4)8-6-5-7-9-18/h18H,5-9H2,1-4H3,(H,14,15,16) |
| InChIKey | MIJYQBMQYPTOCC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|