C9H16ClN3O2S — CID 107206389
N-(5-chloropentyl)-N-methyl-1H-pyrazole-5-sulfonamide (PubChem CID 107206389) has the molecular formula C9H16ClN3O2S and a molecular weight of 265.77 g/mol. Its IUPAC name is N-(5-chloropentyl)-N-methyl-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(5-chloropentyl)-N-methyl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 107206389 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(5-chloropentyl)-N-methyl-1H-pyrazole-5-sulfonamide |
| SMILES | CN(CCCCCCl)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H16ClN3O2S/c1-13(8-4-2-3-6-10)16(14,15)9-5-7-11-12-9/h5,7H,2-4,6,8H2,1H3,(H,11,12) |
| InChIKey | SEHLXNZXVDAIST-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|