C7H14N4O2S — CID 102691082
N-methyl-N-[2-(methylamino)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691082) has the molecular formula C7H14N4O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-methyl-N-[2-(methylamino)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691082 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-methyl-N-[2-(methylamino)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CNCCN(C)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H14N4O2S/c1-8-5-6-11(2)14(12,13)7-3-4-9-10-7/h3-4,8H,5-6H2,1-2H3,(H,9,10) |
| InChIKey | GXBWNXNECZHMGL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |