C7H15ClN4O2S — CID 120718169
N-methyl-N-[2-(methylamino)ethyl]-1H-imidazole-5-sulfonamide;hydrochloride (PubChem CID 120718169) has the molecular formula C7H15ClN4O2S and a molecular weight of 254.74 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)ethyl]-1H-imidazole-5-sulfonamide;hydrochloride.
| Compound Name | N-methyl-N-[2-(methylamino)ethyl]-1H-imidazole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120718169 |
| Molecular Formula | C7H15ClN4O2S |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-methyl-N-[2-(methylamino)ethyl]-1H-imidazole-5-sulfonamide;hydrochloride |
| SMILES | CNCCN(C)S(=O)(=O)c1cnc[nH]1.Cl |
| InChI | InChI=1S/C7H14N4O2S.ClH/c1-8-3-4-11(2)14(12,13)7-5-9-6-10-7;/h5-6,8H,3-4H2,1-2H3,(H,9,10);1H |
| InChIKey | RAVAIGXCSROILX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |