C10H18N4O2S — CID 102693004
N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102693004) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693004 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CN1CCC(CN(C)S(=O)(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C10H18N4O2S/c1-13-6-4-9(7-13)8-14(2)17(15,16)10-3-5-11-12-10/h3,5,9H,4,6-8H2,1-2H3,(H,11,12) |
| InChIKey | WEFGMQAREWXUCI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |