C12H18BrN3O2S — CID 97318384
5-bromo-N-methyl-N-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyridine-2-sulfonamide (PubChem CID 97318384) has the molecular formula C12H18BrN3O2S and a molecular weight of 348.27 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyridine-2-sulfonamide.
| Compound Name | 5-bromo-N-methyl-N-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 97318384 |
| Molecular Formula | C12H18BrN3O2S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-bromo-N-methyl-N-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyridine-2-sulfonamide |
| SMILES | CN1CC[C@H](CN(C)S(=O)(=O)c2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C12H18BrN3O2S/c1-15-6-5-10(8-15)9-16(2)19(17,18)12-4-3-11(13)7-14-12/h3-4,7,10H,5-6,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | GWXJEARWSCORQC-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |