C16H18N2O3 — CID 107207796
4-amino-2-methoxy-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide (PubChem CID 107207796) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-amino-2-methoxy-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide.
| Compound Name | 4-amino-2-methoxy-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide |
|---|---|
| PubChem CID | 107207796 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-amino-2-methoxy-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide |
| SMILES | COc1cc(N)ccc1C(=O)NC1CCCc2occc21 |
| InChI | InChI=1S/C16H18N2O3/c1-20-15-9-10(17)5-6-12(15)16(19)18-13-3-2-4-14-11(13)7-8-21-14/h5-9,13H,2-4,17H2,1H3,(H,18,19) |
| InChIKey | MVHBUYOEEPQBKR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|