C15H13Cl2NO2 — CID 3491146
2,4-dichloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide (PubChem CID 3491146) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 2,4-dichloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide |
|---|---|
| PubChem CID | 3491146 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2,4-dichloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzamide |
| SMILES | O=C(NC1CCCc2occc21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2NO2/c16-9-4-5-10(12(17)8-9)15(19)18-13-2-1-3-14-11(13)6-7-20-14/h4-8,13H,1-3H2,(H,18,19) |
| InChIKey | GUEIPKURPWMJPC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |