C14H12ClFN2O2 — CID 103891865
2-chloro-5-fluoro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide (PubChem CID 103891865) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103891865 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-chloro-5-fluoro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCc2occc21)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C14H12ClFN2O2/c15-13-10(6-8(16)7-17-13)14(19)18-11-2-1-3-12-9(11)4-5-20-12/h4-7,11H,1-3H2,(H,18,19) |
| InChIKey | YKOIZHQVRWUHFA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|