C15H15ClN2O2 — CID 78891837
1-(3-chlorophenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 78891837) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 78891837 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)NC1CCCc2occc21 |
| InChI | InChI=1S/C15H15ClN2O2/c16-10-3-1-4-11(9-10)17-15(19)18-13-5-2-6-14-12(13)7-8-20-14/h1,3-4,7-9,13H,2,5-6H2,(H2,17,18,19) |
| InChIKey | DDFVNLSOTLLXLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |