C17H20N2O2 — CID 78891853
1-(4-ethylphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 78891853) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-(4-ethylphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 78891853 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | CCc1ccc(NC(=O)NC2CCCc3occc32)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-12-6-8-13(9-7-12)18-17(20)19-15-4-3-5-16-14(15)10-11-21-16/h6-11,15H,2-5H2,1H3,(H2,18,19,20) |
| InChIKey | GBTSZVPLVSZFRU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |