C15H16N2O2 — CID 941313
1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea (PubChem CID 941313) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea.
| Compound Name | 1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea |
|---|---|
| PubChem CID | 941313 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1CCCc2occc21 |
| InChI | InChI=1S/C15H16N2O2/c18-15(16-11-5-2-1-3-6-11)17-13-7-4-8-14-12(13)9-10-19-14/h1-3,5-6,9-10,13H,4,7-8H2,(H2,16,17,18)/t13-/m0/s1 |
| InChIKey | BJDXNYDZRUOGFB-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |