C17H20N2O3 — CID 86927702
1-(2-phenoxyethyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 86927702) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(2-phenoxyethyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-(2-phenoxyethyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 86927702 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(2-phenoxyethyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | O=C(NCCOc1ccccc1)NC1CCCc2occc21 |
| InChI | InChI=1S/C17H20N2O3/c20-17(18-10-12-21-13-5-2-1-3-6-13)19-15-7-4-8-16-14(15)9-11-22-16/h1-3,5-6,9,11,15H,4,7-8,10,12H2,(H2,18,19,20) |
| InChIKey | QZBGCWUJBBEJRA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|