C16H19NO2 — CID 115466439
N-(2-phenoxyethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 115466439) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-(2-phenoxyethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 115466439 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(2-phenoxyethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | c1ccc(OCCNC2CCCc3occc32)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-2-5-13(6-3-1)18-12-10-17-15-7-4-8-16-14(15)9-11-19-16/h1-3,5-6,9,11,15,17H,4,7-8,10,12H2 |
| InChIKey | DUVZNPVDVPRKQF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|