C13H21NO4S — CID 124625423
(4R)-N-[2-(2-methylsulfonylethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 124625423) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is (4R)-N-[2-(2-methylsulfonylethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | (4R)-N-[2-(2-methylsulfonylethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 124625423 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (4R)-N-[2-(2-methylsulfonylethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | CS(=O)(=O)CCOCCN[C@@H]1CCCc2occc21 |
| InChI | InChI=1S/C13H21NO4S/c1-19(15,16)10-9-17-8-6-14-12-3-2-4-13-11(12)5-7-18-13/h5,7,12,14H,2-4,6,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | FXFSOKMNKNVCKJ-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|