C15H19N3O3S — CID 99837876
N-[2-[[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]amino]ethyl]pyridine-3-sulfonamide (PubChem CID 99837876) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-[[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 99837876 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[2-[[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]amino]ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCN[C@H]1CCCc2occc21)c1cccnc1 |
| InChI | InChI=1S/C15H19N3O3S/c19-22(20,12-3-2-7-16-11-12)18-9-8-17-14-4-1-5-15-13(14)6-10-21-15/h2-3,6-7,10-11,14,17-18H,1,4-5,8-9H2/t14-/m0/s1 |
| InChIKey | UITSYQPUEMJJRT-AWEZNQCLSA-N |
| XLogP | 1.62 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|