C16H19NO2 — CID 115466423
4-[2-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)ethyl]phenol (PubChem CID 115466423) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[2-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)ethyl]phenol.
| Compound Name | 4-[2-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 115466423 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-[2-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)ethyl]phenol |
| SMILES | Oc1ccc(CCNC2CCCc3occc32)cc1 |
| InChI | InChI=1S/C16H19NO2/c18-13-6-4-12(5-7-13)8-10-17-15-2-1-3-16-14(15)9-11-19-16/h4-7,9,11,15,17-18H,1-3,8,10H2 |
| InChIKey | VVUDISAWFAVELC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |