C12H18N2O2 — CID 115466341
4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)butanamide (PubChem CID 115466341) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)butanamide.
| Compound Name | 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)butanamide |
|---|---|
| PubChem CID | 115466341 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)butanamide |
| SMILES | NC(=O)CCCNC1CCCc2occc21 |
| InChI | InChI=1S/C12H18N2O2/c13-12(15)5-2-7-14-10-3-1-4-11-9(10)6-8-16-11/h6,8,10,14H,1-5,7H2,(H2,13,15) |
| InChIKey | XAQHOAZFHVFERB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|