C16H19N3O2S — CID 124514745
N-[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]ethyl]pyridine-3-sulfonamide (PubChem CID 124514745) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 124514745 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCN[C@H]1CCc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C16H19N3O2S/c20-22(21,14-5-3-9-17-12-14)19-11-10-18-16-8-7-13-4-1-2-6-15(13)16/h1-6,9,12,16,18-19H,7-8,10-11H2/t16-/m0/s1 |
| InChIKey | HHKOMVHXIGFTCL-INIZCTEOSA-N |
| XLogP | 1.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|