C22H21N5O3 — CID 78891580
1-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 78891580) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 78891580 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | O=C(Nc1cccc(Cn2nc3ccccn3c2=O)c1)NC1CCCc2occc21 |
| InChI | InChI=1S/C22H21N5O3/c28-21(24-18-7-4-8-19-17(18)10-12-30-19)23-16-6-3-5-15(13-16)14-27-22(29)26-11-2-1-9-20(26)25-27/h1-3,5-6,9-13,18H,4,7-8,14H2,(H2,23,24,28) |
| InChIKey | OTMSUXHRPJIMOW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |