C34H32N2O2S — CID 10721023
benzyl (3S,4S)-4-benzylsulfanyl-3-(2-phenyl-1H-indol-3-yl)piperidine-1-carboxylate (PubChem CID 10721023) has the molecular formula C34H32N2O2S and a molecular weight of 532.71 g/mol. Its IUPAC name is benzyl (3S,4S)-4-benzylsulfanyl-3-(2-phenyl-1H-indol-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl (3S,4S)-4-benzylsulfanyl-3-(2-phenyl-1H-indol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10721023 |
| Molecular Formula | C34H32N2O2S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | benzyl (3S,4S)-4-benzylsulfanyl-3-(2-phenyl-1H-indol-3-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H](SCc2ccccc2)[C@@H](c2c(-c3ccccc3)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C34H32N2O2S/c37-34(38-23-25-12-4-1-5-13-25)36-21-20-31(39-24-26-14-6-2-7-15-26)29(22-36)32-28-18-10-11-19-30(28)35-33(32)27-16-8-3-9-17-27/h1-19,29,31,35H,20-24H2/t29-,31-/m0/s1 |
| InChIKey | XQVQGPYRLSKXIZ-SMCANUKXSA-N |
| XLogP | 8.26 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |