C13H18N2O2 — CID 107210532
3-(4-aminophenyl)-1-(3-hydroxy-3-methylazetidin-1-yl)propan-1-one (PubChem CID 107210532) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1-(3-hydroxy-3-methylazetidin-1-yl)propan-1-one.
| Compound Name | 3-(4-aminophenyl)-1-(3-hydroxy-3-methylazetidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 107210532 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-(4-aminophenyl)-1-(3-hydroxy-3-methylazetidin-1-yl)propan-1-one |
| SMILES | CC1(O)CN(C(=O)CCc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C13H18N2O2/c1-13(17)8-15(9-13)12(16)7-4-10-2-5-11(14)6-3-10/h2-3,5-6,17H,4,7-9,14H2,1H3 |
| InChIKey | CWCLOYPAVGSRIE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|