C11H16N2O3S — CID 107212018
(3R)-1-(2-amino-6-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 107212018) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is (3R)-1-(2-amino-6-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(2-amino-6-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 107212018 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3R)-1-(2-amino-6-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | Cc1cccc(N)c1S(=O)(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H16N2O3S/c1-8-3-2-4-10(12)11(8)17(15,16)13-6-5-9(14)7-13/h2-4,9,14H,5-7,12H2,1H3/t9-/m1/s1 |
| InChIKey | MZIMAGOHUARLSY-SECBINFHSA-N |
| XLogP | 0.33 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|