C13H21N3O2S — CID 63604384
2-(3,4-dimethylpiperazin-1-yl)sulfonyl-3-methylaniline (PubChem CID 63604384) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(3,4-dimethylpiperazin-1-yl)sulfonyl-3-methylaniline.
| Compound Name | 2-(3,4-dimethylpiperazin-1-yl)sulfonyl-3-methylaniline |
|---|---|
| PubChem CID | 63604384 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(3,4-dimethylpiperazin-1-yl)sulfonyl-3-methylaniline |
| SMILES | Cc1cccc(N)c1S(=O)(=O)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10-5-4-6-12(14)13(10)19(17,18)16-8-7-15(3)11(2)9-16/h4-6,11H,7-9,14H2,1-3H3 |
| InChIKey | HINJYQKXTKQHIZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|