C14H22N2O3S2 — CID 107212892
1-[2-(4-aminophenyl)sulfanylethylsulfonyl]-3-propylazetidin-3-ol (PubChem CID 107212892) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)sulfanylethylsulfonyl]-3-propylazetidin-3-ol.
| Compound Name | 1-[2-(4-aminophenyl)sulfanylethylsulfonyl]-3-propylazetidin-3-ol |
|---|---|
| PubChem CID | 107212892 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[2-(4-aminophenyl)sulfanylethylsulfonyl]-3-propylazetidin-3-ol |
| SMILES | CCCC1(O)CN(S(=O)(=O)CCSc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-2-7-14(17)10-16(11-14)21(18,19)9-8-20-13-5-3-12(15)4-6-13/h3-6,17H,2,7-11,15H2,1H3 |
| InChIKey | PVRDARKRVABFMI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|