C14H22N2O3S2 — CID 104957681
4-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethylsulfanyl]aniline (PubChem CID 104957681) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethylsulfanyl]aniline.
| Compound Name | 4-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethylsulfanyl]aniline |
|---|---|
| PubChem CID | 104957681 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethylsulfanyl]aniline |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCSc2ccc(N)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-11-9-16(10-12(2)19-11)21(17,18)8-7-20-14-5-3-13(15)4-6-14/h3-6,11-12H,7-10,15H2,1-2H3/t11-,12+ |
| InChIKey | OMPMDVQWZGIPIN-TXEJJXNPSA-N |
| XLogP | 1.80 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|