About 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol
2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 107213906) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol |
| PubChem CID | 107213906 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | CCOc1cc(N)cc(N2CCCN(CCO)CC2)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-2-20-15-11-13(16)10-14(12-15)18-5-3-4-17(6-7-18)8-9-19/h10-12,19H,2-9,16H2,1H3 |
| InChIKey | AZYDDRUMADYLSD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol?
The IUPAC name of 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol (CID 107213906) is 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol.
What is the SMILES notation for 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol?
The canonical SMILES for 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol is CCOc1cc(N)cc(N2CCCN(CCO)CC2)c1.
What is the InChIKey of 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol?
The InChIKey is AZYDDRUMADYLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-2-20-15-11-13(16)10-14(12-15)18-5-3-4-17(6-7-18)8-9-19/h10-12,19H,2-9,16H2,1H3.
What are the key properties of 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol?
2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol has a molecular weight of 279.38 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-amino-5-ethoxyphenyl)-1,4-diazepan-1-yl]ethanol is sourced from PubChem (CID 107213906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).