C5H8O3 — CID 107214
2,5-Dimethyl-1,3-dioxolan-4-one (PubChem CID 107214) has the molecular formula C5H8O3 and a molecular weight of 116.11 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-dioxolan-4-one.
| Compound Name | 2,5-Dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 107214 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.11 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC1C(=O)OC(O1)C |
| InChI | InChI=1S/C5H8O3/c1-3-5(6)8-4(2)7-3/h3-4H,1-2H3 |
| InChIKey | HZEDJCAGLIJEAI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 110 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.11 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |