C5H8O3 — CID 15140209
(2S,5S)-2,5-dimethyl-1,3-dioxolan-4-one (PubChem CID 15140209) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2,5-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 15140209 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | C[C@@H]1OC(=O)[C@H](C)O1 |
| InChI | InChI=1S/C5H8O3/c1-3-5(6)8-4(2)7-3/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | HZEDJCAGLIJEAI-IMJSIDKUSA-N |
| XLogP | 0.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |