C13H13F2NO4 — CID 107214958
4,5-difluoro-2-[(3S)-3-hydroxypiperidine-1-carbonyl]benzoic acid (PubChem CID 107214958) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is 4,5-difluoro-2-[(3S)-3-hydroxypiperidine-1-carbonyl]benzoic acid.
| Compound Name | 4,5-difluoro-2-[(3S)-3-hydroxypiperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 107214958 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4,5-difluoro-2-[(3S)-3-hydroxypiperidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1C(=O)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H13F2NO4/c14-10-4-8(9(13(19)20)5-11(10)15)12(18)16-3-1-2-7(17)6-16/h4-5,7,17H,1-3,6H2,(H,19,20)/t7-/m0/s1 |
| InChIKey | NHWRTDXDXUTHNA-ZETCQYMHSA-N |
| XLogP | 1.26 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |