C12H14FN3O4 — CID 62186321
(5-amino-4-fluoro-2-nitrophenyl)-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 62186321) has the molecular formula C12H14FN3O4 and a molecular weight of 283.26 g/mol. Its IUPAC name is (5-amino-4-fluoro-2-nitrophenyl)-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | (5-amino-4-fluoro-2-nitrophenyl)-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 62186321 |
| Molecular Formula | C12H14FN3O4 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (5-amino-4-fluoro-2-nitrophenyl)-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCCC(O)C2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H14FN3O4/c13-9-5-11(16(19)20)8(4-10(9)14)12(18)15-3-1-2-7(17)6-15/h4-5,7,17H,1-3,6,14H2 |
| InChIKey | HEYQDPHUBBOTAI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|