C11H9FN4O5 — CID 66061269
4-(5-amino-4-fluoro-2-nitrobenzoyl)piperazine-2,6-dione (PubChem CID 66061269) has the molecular formula C11H9FN4O5 and a molecular weight of 296.21 g/mol. Its IUPAC name is 4-(5-amino-4-fluoro-2-nitrobenzoyl)piperazine-2,6-dione.
| Compound Name | 4-(5-amino-4-fluoro-2-nitrobenzoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66061269 |
| Molecular Formula | C11H9FN4O5 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-(5-amino-4-fluoro-2-nitrobenzoyl)piperazine-2,6-dione |
| SMILES | Nc1cc(C(=O)N2CC(=O)NC(=O)C2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H9FN4O5/c12-6-2-8(16(20)21)5(1-7(6)13)11(19)15-3-9(17)14-10(18)4-15/h1-2H,3-4,13H2,(H,14,17,18) |
| InChIKey | MIFDOGZRWWSXRD-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|