About 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione
4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione (PubChem CID 79772834) has the molecular formula C11H9F2N3O3
and a molecular weight of 269.21 g/mol. Its IUPAC name is 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione |
| PubChem CID | 79772834 |
| Molecular Formula | C11H9F2N3O3 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione |
| SMILES | Nc1ccc(F)c(C(=O)N2CC(=O)NC(=O)C2)c1F |
| InChI | InChI=1S/C11H9F2N3O3/c12-5-1-2-6(14)10(13)9(5)11(19)16-3-7(17)15-8(18)4-16/h1-2H,3-4,14H2,(H,15,17,18) |
| InChIKey | ZPEAJCBACLTUMG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione?
The IUPAC name of 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione (CID 79772834) is 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione.
What is the SMILES notation for 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione?
The canonical SMILES for 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione is Nc1ccc(F)c(C(=O)N2CC(=O)NC(=O)C2)c1F.
What is the InChIKey of 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione?
The InChIKey is ZPEAJCBACLTUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N3O3/c12-5-1-2-6(14)10(13)9(5)11(19)16-3-7(17)15-8(18)4-16/h1-2H,3-4,14H2,(H,15,17,18).
What are the key properties of 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione?
4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione has a molecular weight of 269.21 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-2,6-difluorobenzoyl)piperazine-2,6-dione is sourced from PubChem (CID 79772834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).